Difference between revisions of "P-AMINO-BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3713 == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o * in...") |
(Created page with "Category:metabolite == Metabolite O-phospho-tau-proteins == * common-name: ** an o-phospho-tau protein == Reaction(s) known to consume the compound == * TAU-PROTEIN-KINA...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite O-phospho-tau-proteins == |
* common-name: | * common-name: | ||
− | ** | + | ** an o-phospho-tau protein |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[TAU-PROTEIN-KINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TAU-PROTEIN-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an o-phospho-tau protein}} |
− | |||
− |
Revision as of 13:11, 14 January 2021
Contents
Metabolite O-phospho-tau-proteins
- common-name:
- an o-phospho-tau protein