Difference between revisions of "P-AMINO-BENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3713 == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o * in...")
(Created page with "Category:metabolite == Metabolite O-phospho-tau-proteins == * common-name: ** an o-phospho-tau protein == Reaction(s) known to consume the compound == * TAU-PROTEIN-KINA...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3713 ==
+
== Metabolite O-phospho-tau-proteins ==
 
* common-name:
 
* common-name:
** cytidine 2',3'-cyclic monophosphate
+
** an o-phospho-tau protein
* smiles:
 
** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
 
* inchi-key:
 
** nmpzcczxcomsdq-xvfcmesisa-m
 
* molecular-weight:
 
** 304.176
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12059]]
+
* [[TAU-PROTEIN-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=an o-phospho-tau protein}}
{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
 
{{#set: molecular-weight=304.176}}
 

Revision as of 13:11, 14 January 2021

Metabolite O-phospho-tau-proteins

  • common-name:
    • an o-phospho-tau protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality