Difference between revisions of "P-AMINO-BENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-phospho-tau-proteins == * common-name: ** an o-phospho-tau protein == Reaction(s) known to consume the compound == * TAU-PROTEIN-KINA...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1456-TETRAKISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5,6)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-phospho-tau-proteins ==
+
== Metabolite INOSITOL-1456-TETRAKISPHOSPHATE ==
 
* common-name:
 
* common-name:
** an o-phospho-tau protein
+
** d-myo-inositol (1,4,5,6)-tetrakisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
 +
* inchi-key:
 +
** mrvyfoanpdtyby-yortwtkjsa-f
 +
* molecular-weight:
 +
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TAU-PROTEIN-KINASE-RXN]]
+
* [[RXN-7162]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TAU-PROTEIN-KINASE-RXN]]
+
* [[2.7.1.151-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an o-phospho-tau protein}}
+
{{#set: common-name=d-myo-inositol (1,4,5,6)-tetrakisphosphate}}
 +
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-yortwtkjsa-f}}
 +
{{#set: molecular-weight=492.013}}

Revision as of 18:57, 14 January 2021

Metabolite INOSITOL-1456-TETRAKISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4,5,6)-tetrakisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mrvyfoanpdtyby-yortwtkjsa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality