Difference between revisions of "P-AMINO-BENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] == * direction: ** left-to-right == Reaction formula == * 1 3Prime-OH-Termin...")
 
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-])c1(c=cc(=cc=1)n) * inchi-key: ** alynczndiqevrv-uhfffaoysa-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] ==
+
== Metabolite P-AMINO-BENZOATE ==
* direction:
+
* common-name:
** left-to-right
+
** 4-aminobenzoate
== Reaction formula ==
+
* smiles:
* 1 [[3Prime-OH-Terminated-RNAs]][c] '''+''' 1 [[A-5-prime-PP-5-prime-RNA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[RNA-Holder]][c]
+
** c(=o)([o-])c1(c=cc(=cc=1)n)
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ03634]]
+
** alynczndiqevrv-uhfffaoysa-m
** Category: [[annotation]]
+
* molecular-weight:
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 136.13
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[ADCLY-RXN]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[H2PTEROATESYNTH-RXN]]
== External links  ==
+
== Reaction(s) known to produce the compound ==
{{#set: direction=left-to-right}}
+
* [[ADCLY-RXN]]
{{#set: nb gene associated=1}}
+
== Reaction(s) of unknown directionality ==
{{#set: nb pathway associated=0}}
+
{{#set: common-name=4-aminobenzoate}}
{{#set: reconstruction category=annotation}}
+
{{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular-weight=136.13}}
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite P-AMINO-BENZOATE

  • common-name:
    • 4-aminobenzoate
  • smiles:
    • c(=o)([o-])c1(c=cc(=cc=1)n)
  • inchi-key:
    • alynczndiqevrv-uhfffaoysa-m
  • molecular-weight:
    • 136.13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality