Difference between revisions of "P-COUMAROYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...")
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRO-NEO-PTERIN ==
+
== Metabolite P-COUMAROYL-COA ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin
+
** 4-coumaroyl-coa
 
* smiles:
 
* smiles:
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** yqifamynggotfb-xinawcovsa-n
+
** dmzokbalnzwdki-matmfaihsa-j
 
* molecular-weight:
 
* molecular-weight:
** 255.233
+
** 909.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2NEOPTERINALDOL-RXN]]
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[RXN-1101]]
 +
* [[RXN-11244]]
 +
* [[RXN-3142]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin}}
+
{{#set: common-name=4-coumaroyl-coa}}
{{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}}
+
{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}
{{#set: molecular-weight=255.233}}
+
{{#set: molecular-weight=909.648}}

Latest revision as of 11:11, 18 March 2021

Metabolite P-COUMAROYL-COA

  • common-name:
    • 4-coumaroyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • dmzokbalnzwdki-matmfaihsa-j
  • molecular-weight:
    • 909.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality