Difference between revisions of "P-COUMAROYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02939 == * transcription-direction: ** negative * right-end-position: ** 125843 * left-end-position: ** 119155 * centisome-position: ** 93.59217...") |
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite P-COUMAROYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** 4-coumaroyl-coa |
− | + | * smiles: | |
− | * | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
− | + | * inchi-key: | |
− | ** | + | ** dmzokbalnzwdki-matmfaihsa-j |
− | + | * molecular-weight: | |
− | + | ** 909.648 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | |
− | = | + | * [[RXN-1101]] |
− | + | * [[RXN-11244]] | |
− | * | + | * [[RXN-3142]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[4-COUMARATE--COA-LIGASE-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | ** | + | {{#set: common-name=4-coumaroyl-coa}} |
− | * [[RXN | + | {{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}} |
− | + | {{#set: molecular-weight=909.648}} | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite P-COUMAROYL-COA
- common-name:
- 4-coumaroyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- dmzokbalnzwdki-matmfaihsa-j
- molecular-weight:
- 909.648