Difference between revisions of "P-COUMAROYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12484 == * transcription-direction: ** positive * right-end-position: ** 434380 * left-end-position: ** 416145 * centisome-position: ** 55.524498...") |
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite P-COUMAROYL-COA == |
| − | * | + | * common-name: |
| − | ** | + | ** 4-coumaroyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** dmzokbalnzwdki-matmfaihsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 909.648 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | |
| − | == Reaction(s) | + | * [[RXN-1101]] |
| − | * [[ | + | * [[RXN-11244]] |
| − | * | + | * [[RXN-3142]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=4-coumaroyl-coa}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}} |
| − | + | {{#set: molecular-weight=909.648}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite P-COUMAROYL-COA
- common-name:
- 4-coumaroyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- dmzokbalnzwdki-matmfaihsa-j
- molecular-weight:
- 909.648
