Difference between revisions of "P-COUMAROYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G5-pppR-mRNAs == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-G...") |
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite P-COUMAROYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-coumaroyl-coa |
+ | * smiles: | ||
+ | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** dmzokbalnzwdki-matmfaihsa-j | ||
+ | * molecular-weight: | ||
+ | ** 909.648 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] |
+ | * [[RXN-1101]] | ||
+ | * [[RXN-11244]] | ||
+ | * [[RXN-3142]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-coumaroyl-coa}} |
+ | {{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}} | ||
+ | {{#set: molecular-weight=909.648}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite P-COUMAROYL-COA
- common-name:
- 4-coumaroyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- dmzokbalnzwdki-matmfaihsa-j
- molecular-weight:
- 909.648