Difference between revisions of "P-COUMAROYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03239 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.25.1-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite P-COUMAROYL-COA == |
| − | == | + | * common-name: |
| − | + | ** 4-coumaroyl-coa | |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
| − | ** | + | * inchi-key: |
| − | * | + | ** dmzokbalnzwdki-matmfaihsa-j |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 909.648 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | ||
| + | * [[RXN-1101]] | ||
| + | * [[RXN-11244]] | ||
| + | * [[RXN-3142]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[4-COUMARATE--COA-LIGASE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=4-coumaroyl-coa}} | ||
| + | {{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}} | ||
| + | {{#set: molecular-weight=909.648}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite P-COUMAROYL-COA
- common-name:
- 4-coumaroyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- dmzokbalnzwdki-matmfaihsa-j
- molecular-weight:
- 909.648
