Difference between revisions of "P-COUMAROYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...")
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE ==
+
== Metabolite P-COUMAROYL-COA ==
 
* common-name:
 
* common-name:
** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
+
** 4-coumaroyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** bjlpwucpfajinb-uaqstnrtsa-l
+
** dmzokbalnzwdki-matmfaihsa-j
 
* molecular-weight:
 
* molecular-weight:
** 442.531
+
** 909.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.42-RXN]]
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[RXN-1101]]
 +
* [[RXN-11244]]
 +
* [[RXN-3142]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.41-RXN]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=4-coumaroyl-coa}}
{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
+
{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}
{{#set: molecular-weight=442.531}}
+
{{#set: molecular-weight=909.648}}

Latest revision as of 11:11, 18 March 2021

Metabolite P-COUMAROYL-COA

  • common-name:
    • 4-coumaroyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • dmzokbalnzwdki-matmfaihsa-j
  • molecular-weight:
    • 909.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality