Difference between revisions of "P-COUMAROYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G5-pppR-mRNAs == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-G...") |
(Created page with "Category:metabolite == Metabolite CPD-13670 == * common-name: ** 30-hydroxy-11-oxo-β-amyrin * smiles: ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13670 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 30-hydroxy-11-oxo-β-amyrin |
| + | * smiles: | ||
| + | ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c | ||
| + | * inchi-key: | ||
| + | ** jcgxiyqlryphdg-zbyjljtqsa-n | ||
| + | * molecular-weight: | ||
| + | ** 456.707 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13493]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13492]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=30-hydroxy-11-oxo-β-amyrin}} |
| + | {{#set: inchi-key=inchikey=jcgxiyqlryphdg-zbyjljtqsa-n}} | ||
| + | {{#set: molecular-weight=456.707}} | ||
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD-13670
- common-name:
- 30-hydroxy-11-oxo-β-amyrin
- smiles:
- cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
- inchi-key:
- jcgxiyqlryphdg-zbyjljtqsa-n
- molecular-weight:
- 456.707
