Difference between revisions of "P-COUMAROYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...")
(Created page with "Category:metabolite == Metabolite CPD-17351 == * smiles: ** cccccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name: ** a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE ==
+
== Metabolite CPD-17351 ==
 +
* smiles:
 +
** cccccc=ccc=ccccccccccc(=o)[a glycerolipid]
 
* common-name:
 
* common-name:
** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
+
** a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
 
* inchi-key:
 
** bjlpwucpfajinb-uaqstnrtsa-l
 
* molecular-weight:
 
** 442.531
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.42-RXN]]
+
* [[RXN-16099]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.41-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate}}
{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
 
{{#set: molecular-weight=442.531}}
 

Revision as of 18:52, 14 January 2021

Metabolite CPD-17351

  • smiles:
    • cccccc=ccc=ccccccccccc(=o)[a glycerolipid]
  • common-name:
    • a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.