Difference between revisions of "P-HYDROXY-PHENYLPYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/6....")
 
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 4-hydroxyphenylpyruvate * smiles: ** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o) * inchi-key: ** kkad...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] ==
+
== Metabolite P-HYDROXY-PHENYLPYRUVATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 4-hydroxyphenylpyruvate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.2.1 ec-6.2.1]
+
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-674]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CINNAMOYL-COA]][c] '''+''' 1 [[PPI]][c]
+
** kkadpxvioxhvkn-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03066]]
+
** 179.152
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
−
* Gene: [[SJ16901]]
+
* [[HPPD]]
−
** Category: [[orthology]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
−
* [[PWY-6457]], cinnamoyl-CoA biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6457 PWY-6457]
+
* [[PREPHENATEDEHYDROG-RXN]]
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=4-hydroxyphenylpyruvate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}
−
* LIGAND-RXN:
+
{{#set: molecular-weight=179.152}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R02255 R02255]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-6.2.1}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite P-HYDROXY-PHENYLPYRUVATE

  • common-name:
    • 4-hydroxyphenylpyruvate
  • smiles:
    • c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
  • inchi-key:
    • kkadpxvioxhvkn-uhfffaoysa-m
  • molecular-weight:
    • 179.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=P-HYDROXY-PHENYLPYRUVATE&oldid=139311"