Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-396 == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)n) * inchi-key: ** ldhmavipbrsvrg-uhfffaoysa-o * mo...") |
(Created page with "Category:metabolite == Metabolite N-terminal-PPK == * common-name: ** an n-terminal-ppk-[protein] == Reaction(s) known to consume the compound == * RXN-13226 * RXN-1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-terminal-PPK == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal-ppk-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13226]] | ||
| + | * [[RXN-13227]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal-ppk-[protein]}} |
| − | |||
| − | |||
Revision as of 11:13, 15 January 2021
Contents
Metabolite N-terminal-PPK
- common-name:
- an n-terminal-ppk-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal-ppk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
