Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * smiles: ** co * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * molecular-weight: ** 32.042 == Reaction...")
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METOH ==
+
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
 
* common-name:
 
* common-name:
** methanol
+
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
 
* smiles:
 
* smiles:
** co
+
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 
* inchi-key:
 
* inchi-key:
** okkjlvbelutlkv-uhfffaoysa-n
+
** naqghjtuzrhgac-lbgugvgysa-j
 
* molecular-weight:
 
* molecular-weight:
** 32.042
+
** 450.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHANOL-DEHYDROGENASE-RXN]]
+
* [[AIAL]]
* [[RXN-14189]]
+
* [[AICARSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHANOL-DEHYDROGENASE-RXN]]
+
* [[AIAL]]
* [[RXN-10711]]
+
* [[AICARSYN-RXN]]
* [[RXN-10767]]
+
* [[SAICARSYN-RXN]]
* [[RXN-12322]]
 
* [[RXN-15776]]
 
* [[RXN-8409]]
 
* [[RXNQT-4366]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methanol}}
+
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
{{#set: inchi-key=inchikey=okkjlvbelutlkv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
{{#set: molecular-weight=32.042}}
+
{{#set: molecular-weight=450.255}}

Latest revision as of 11:11, 18 March 2021

Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE

  • common-name:
    • 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
  • inchi-key:
    • naqghjtuzrhgac-lbgugvgysa-j
  • molecular-weight:
    • 450.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality