Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15872 == * transcription-direction: ** negative * right-end-position: ** 274782 * left-end-position: ** 272022 * centisome-position: ** 93.68955...")
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15872 ==
+
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
* transcription-direction:
+
* common-name:
** negative
+
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
* right-end-position:
+
* smiles:
** 274782
+
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
* left-end-position:
+
* inchi-key:
** 272022
+
** naqghjtuzrhgac-lbgugvgysa-j
* centisome-position:
+
* molecular-weight:
** 93.68955   
+
** 450.255
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[AIAL]]
== Reaction(s) associated ==
+
* [[AICARSYN-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[AIAL]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AICARSYN-RXN]]
{{#set: transcription-direction=negative}}
+
* [[SAICARSYN-RXN]]
{{#set: right-end-position=274782}}
+
== Reaction(s) of unknown directionality ==
{{#set: left-end-position=272022}}
+
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
{{#set: centisome-position=93.68955    }}
+
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=450.255}}
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE

  • common-name:
    • 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
  • inchi-key:
    • naqghjtuzrhgac-lbgugvgysa-j
  • molecular-weight:
    • 450.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality