Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CIT == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inchi-key: ** krknybchxyngox-uhfffaoysa-k * molecul...")
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CIT ==
+
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
 
* common-name:
 
* common-name:
** citrate
+
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
 
* smiles:
 
* smiles:
** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
+
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 
* inchi-key:
 
* inchi-key:
** krknybchxyngox-uhfffaoysa-k
+
** naqghjtuzrhgac-lbgugvgysa-j
 
* molecular-weight:
 
* molecular-weight:
** 189.101
+
** 450.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[AIAL]]
* [[AKGCITtm]]
+
* [[AICARSYN-RXN]]
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 
* [[ATPCL]]
 
* [[OAACITtm]]
 
* [[RXN-14047]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[AIAL]]
* [[AKGCITtm]]
+
* [[AICARSYN-RXN]]
* [[CITSYN-RXN]]
+
* [[SAICARSYN-RXN]]
* [[CSm]]
 
* [[OAACITtm]]
 
* [[RXN-14047]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=citrate}}
+
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
{{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
{{#set: molecular-weight=189.101}}
+
{{#set: molecular-weight=450.255}}

Latest revision as of 11:11, 18 March 2021

Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE

  • common-name:
    • 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
  • inchi-key:
    • naqghjtuzrhgac-lbgugvgysa-j
  • molecular-weight:
    • 450.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality