Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15872 == * transcription-direction: ** negative * right-end-position: ** 274782 * left-end-position: ** 272022 * centisome-position: ** 93.68955...") |
(Created page with "Category:metabolite == Metabolite CIT == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inchi-key: ** krknybchxyngox-uhfffaoysa-k * molecul...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CIT == |
| − | * | + | * common-name: |
| − | ** | + | ** citrate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** krknybchxyngox-uhfffaoysa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 189.101 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[S | + | * [[ACONITATEDEHYDR-RXN]] |
| − | == Reaction(s) | + | * [[AKGCITtm]] |
| − | * [[ | + | * [[ATP-CITRATE-PRO-S--LYASE-RXN]] |
| − | ** | + | * [[ATPCL]] |
| − | ** | + | * [[OAACITtm]] |
| − | {{#set: | + | * [[RXN-14047]] |
| − | {{#set: | + | * [[biomass_rxn]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[ACONITATEDEHYDR-RXN]] |
| − | + | * [[AKGCITtm]] | |
| − | + | * [[CITSYN-RXN]] | |
| + | * [[CSm]] | ||
| + | * [[OAACITtm]] | ||
| + | * [[RXN-14047]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=citrate}} | ||
| + | {{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=189.101}} | ||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CIT
- common-name:
- citrate
- smiles:
- c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
- inchi-key:
- krknybchxyngox-uhfffaoysa-k
- molecular-weight:
- 189.101
