Difference between revisions of "P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19170 ==
+
== Metabolite SINAPATE ==
 
* common-name:
 
* common-name:
** (2e,7z)-hexadecenoyl-coa
+
** sinapate
 
* smiles:
 
* smiles:
** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
 
* inchi-key:
 
* inchi-key:
** yqarrkbgbkpbcx-dvzfgldusa-j
+
** pcmortlopmlefb-onegzznksa-m
 
* molecular-weight:
 
* molecular-weight:
** 997.883
+
** 223.205
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17780]]
+
* [[RXN-10919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17779]]
+
* [[RXN-3422]]
 +
* [[RXN-8014]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
+
{{#set: common-name=sinapate}}
{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
+
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
{{#set: molecular-weight=997.883}}
+
{{#set: molecular-weight=223.205}}

Revision as of 15:25, 5 January 2021

Metabolite SINAPATE

  • common-name:
    • sinapate
  • smiles:
    • coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
  • inchi-key:
    • pcmortlopmlefb-onegzznksa-m
  • molecular-weight:
    • 223.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality