Difference between revisions of "P105-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-520 CPDQT-520] == * common-name: ** phosphatidylglycerophosphate (1-octadecenoyl(9z), 2-p...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-520 CPDQT-520] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
 
* common-name:
 
* common-name:
** phosphatidylglycerophosphate (1-octadecenoyl(9z), 2-palmitoyl)
+
** phytenate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)occ(cop(occ(o)cop([o-])(=o)[o-])([o-])=o)oc(=o)ccccccccccccccc
+
** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** wqmdyqsttxrxlq-hgwhepcssa-k
+
** wdwbnnbrpveeod-pfxvradusa-m
 
* molecular-weight:
 
* molecular-weight:
** 825.972
+
** 309.511
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13313]]
+
* [[RXN66-480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphatidylglycerophosphate (1-octadecenoyl(9z), 2-palmitoyl)}}
+
{{#set: common-name=phytenate}}
{{#set: inchi-key=inchikey=wqmdyqsttxrxlq-hgwhepcssa-k}}
+
{{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}}
{{#set: molecular-weight=825.972}}
+
{{#set: molecular-weight=309.511}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-14927

  • common-name:
    • phytenate
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
  • inchi-key:
    • wdwbnnbrpveeod-pfxvradusa-m
  • molecular-weight:
    • 309.511

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality