Difference between revisions of "P122-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
+== Pathway P122-PWY ==
+* taxonomic-range:
+** tax-1239
 * common-name:
-** l-canavanine
+** heterolactic fermentation
-* smiles:
+== Reaction(s) found ==
-** c(cc([n+])c(=o)[o-])onc(=[n+])n
+* [[2PGADEHYDRAT-RXN]]
-* inchi-key:
+* [[6PGLUCONDEHYDROG-RXN]]
-** fsbigdsbmbyopn-vkhmyheasa-o
+* [[6PGLUCONOLACT-RXN]]
-* molecular-weight:
+* [[ALCOHOL-DEHYDROG-RXN]]
-** 177.183
+* [[DLACTDEHYDROGNAD-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[FRUCTOKINASE-RXN]]
-* [[RXN-34]]
+* [[GAPOXNPHOSPHN-RXN]]
-== Reaction(s) known to produce the compound ==
+* [[GLU6PDEHYDROG-RXN]]
-* [[RXN-22]]
+* [[GLUCOKIN-RXN]]
-== Reaction(s) of unknown directionality ==
+* [[L-LACTATE-DEHYDROGENASE-RXN]]
-{{#set: common-name=l-canavanine}}
+* [[PEPDEPHOS-RXN]]
-{{#set: inchi-key=inchikey=fsbigdsbmbyopn-vkhmyheasa-o}}
+* [[PGLUCISOM-RXN]]
-{{#set: molecular-weight=177.183}}
+* [[PHOSACETYLTRANS-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RIBULP3EPIM-RXN]]
+* [[RXN-15513]]
+== Reaction(s) not found ==
+* [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]
+* [NonePHOSPHOKETOLASE-RXN PHOSPHOKETOLASE-RXN]
+{{#set: taxonomic-range=tax-1239}}
+{{#set: common-name=heterolactic fermentation}}
+{{#set: nb reaction found=16}}
+{{#set: completion rate=0.89}}
+{{#set: nb total reaction=18}}