Difference between revisions of "P124-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] == * common-name: ** vanillyl mandelate * smiles: ** coc...")
(Created page with "Category:pathway == Pathway P124-PWY == * taxonomic-range: ** tax-201174 * common-name: ** bifidobacterium shunt == Reaction(s) found == * 1TRANSKETO-RXN * 2PGADEHYD...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] ==
+
== Pathway P124-PWY ==
 +
* taxonomic-range:
 +
** tax-201174
 
* common-name:
 
* common-name:
** vanillyl mandelate
+
** bifidobacterium shunt
* smiles:
+
== Reaction(s) found ==
** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
+
* [[1TRANSKETO-RXN]]
* inchi-key:
+
* [[2PGADEHYDRAT-RXN]]
** cgqcwmiaepehnq-mrvpvssysa-m
+
* [[3PGAREARR-RXN]]
* molecular-weight:
+
* [[GAPOXNPHOSPHN-RXN]]
** 197.167
+
* [[GLUCOKIN-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[L-LACTATE-DEHYDROGENASE-RXN]]
== Reaction(s) known to produce the compound ==
+
* [[PEPDEPHOS-RXN]]
* [[RXN-10917]]
+
* [[PGLUCISOM-RXN]]
== Reaction(s) of unknown directionality ==
+
* [[PHOSGLYPHOS-RXN]]
{{#set: common-name=vanillyl mandelate}}
+
* [[RIB5PISOM-RXN]]
{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
+
* [[RIBULP3EPIM-RXN]]
{{#set: molecular-weight=197.167}}
+
* [[TRANSALDOL-RXN]]
 +
== Reaction(s) not found ==
 +
* [NoneFRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN FRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN]
 +
* [NoneACETATEKIN-RXN ACETATEKIN-RXN]
 +
* [NonePHOSPHOKETOLASE-RXN PHOSPHOKETOLASE-RXN]
 +
{{#set: taxonomic-range=tax-201174}}
 +
{{#set: common-name=bifidobacterium shunt}}
 +
{{#set: nb reaction found=12}}
 +
{{#set: completion rate=0.8}}
 +
{{#set: nb total reaction=15}}

Latest revision as of 10:58, 18 March 2021

Pathway P124-PWY

  • taxonomic-range:
    • tax-201174
  • common-name:
    • bifidobacterium shunt

Reaction(s) found

Reaction(s) not found

  • [NoneFRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN FRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN]
  • [NoneACETATEKIN-RXN ACETATEKIN-RXN]
  • [NonePHOSPHOKETOLASE-RXN PHOSPHOKETOLASE-RXN]