Difference between revisions of "P124-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] == * common-name: ** vanillyl mandelate * smiles: ** coc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] ==
 
* common-name:
 
* common-name:
** vanillyl mandelate
+
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
 
* smiles:
 
* smiles:
** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
+
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
 
* inchi-key:
 
* inchi-key:
** cgqcwmiaepehnq-mrvpvssysa-m
+
** chbulttudaiwdp-hcihmxrssa-n
 
* molecular-weight:
 
* molecular-weight:
** 197.167
+
** 586.634
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10917]]
+
* [[RXN-15681]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=vanillyl mandelate}}
+
{{#set: common-name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}}
{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
+
{{#set: inchi-key=inchikey=chbulttudaiwdp-hcihmxrssa-n}}
{{#set: molecular-weight=197.167}}
+
{{#set: molecular-weight=586.634}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-17047

  • common-name:
    • 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
  • inchi-key:
    • chbulttudaiwdp-hcihmxrssa-n
  • molecular-weight:
    • 586.634

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality