Difference between revisions of "P142-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2340 CPD0-2340] == * common-name: ** (z)-3-peroxyaminoacrylate * smiles: ** [ch](n)=cc(=o)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * common-name: ** sn-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** sn-glycero-3-phosphoethanolamine |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(op([o-])(occ(co)o)=o)c[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jznwscpgtdbmew-rxmqykedsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 215.142 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14160]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15035]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sn-glycero-3-phosphoethanolamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=215.142}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- common-name:
- sn-glycero-3-phosphoethanolamine
- smiles:
- c(op([o-])(occ(co)o)=o)c[n+]
- inchi-key:
- jznwscpgtdbmew-rxmqykedsa-n
- molecular-weight:
- 215.142
