Difference between revisions of "P161-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
+== Pathway P161-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 3,3',5-triiodothyroacetate
+** acetylene degradation
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
+* [[ALCOHOL-DEHYDROG-RXN]]
-* inchi-key:
+* [[PHOSACETYLTRANS-RXN]]
-** uowzuvnaguaeqc-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneR141-RXN R141-RXN]
-** 620.928
+* [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneACETATEKIN-RXN ACETATEKIN-RXN]
-* [[RXN-10618]]
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-10619]]
+{{#set: common-name=acetylene degradation}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.4}}
-{{#set: common-name=3,3',5-triiodothyroacetate}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
-{{#set: molecular-weight=620.928}}