Difference between revisions of "P161-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycogens Glycogens] == * common-name: ** a glycogen == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycogens Glycogens] ==
 
* common-name:
 
* common-name:
** 3,3',5-triiodothyroacetate
+
** a glycogen
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
 
* inchi-key:
 
** uowzuvnaguaeqc-uhfffaoysa-m
 
* molecular-weight:
 
** 620.928
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10618]]
+
* [[GLYCOPHOSPHORYL-RXN]]
* [[RXN-10619]]
+
* [[GLYMALTOPHOSPHORYL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,3',5-triiodothyroacetate}}
+
{{#set: common-name=a glycogen}}
{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
 
{{#set: molecular-weight=620.928}}
 

Revision as of 09:22, 27 August 2019

Metabolite Glycogens

  • common-name:
    • a glycogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality