Difference between revisions of "P163-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] == * common-name: ** 6-cis, 3-oxo-tridecenoyl-coa * smiles: ** ccccccc=ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * common-name: ** s-adenosyl 3-(methylthi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] ==
 
* common-name:
 
* common-name:
** 6-cis, 3-oxo-tridecenoyl-coa
+
** s-adenosyl 3-(methylthio)propylamine
 
* smiles:
 
* smiles:
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 
* inchi-key:
 
* inchi-key:
** fdxhxlpclxeysu-dxazuofzsa-j
+
** zunbitixdcpnsd-lsrjevitsa-o
 
* molecular-weight:
 
* molecular-weight:
** 971.802
+
** 356.442
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14774]]
+
* [[APAPT]]
 +
* [[RXN-11190]]
 +
* [[RXN0-5217]]
 +
* [[SPERMIDINESYN-RXN]]
 +
* [[SPERMINE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMCL]]
 +
* [[RXN-11190]]
 +
* [[SAMDECARB-RXN]]
 +
* [[SPERMIDINESYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}}
+
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
{{#set: molecular-weight=971.802}}
+
{{#set: molecular-weight=356.442}}

Revision as of 14:19, 26 August 2019

Metabolite S-ADENOSYLMETHIONINAMINE

  • common-name:
    • s-adenosyl 3-(methylthio)propylamine
  • smiles:
    • c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
  • inchi-key:
    • zunbitixdcpnsd-lsrjevitsa-o
  • molecular-weight:
    • 356.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality