Difference between revisions of "P163-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * common-name: ** s-adenosyl 3-(methylthi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == * common-name: ** α-gluco...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] ==
 
* common-name:
 
* common-name:
** s-adenosyl 3-(methylthio)propylamine
+
** α-glucose 1,6-bisphosphate
 
* smiles:
 
* smiles:
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
 
* inchi-key:
 
* inchi-key:
** zunbitixdcpnsd-lsrjevitsa-o
+
** rwhozgraxywrnx-vfuothlcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 356.442
+
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APAPT]]
+
* [[RXN-16998]]
* [[RXN-11190]]
 
* [[RXN0-5217]]
 
* [[SPERMIDINESYN-RXN]]
 
* [[SPERMINE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMCL]]
+
* [[RXN-16997]]
* [[RXN-11190]]
 
* [[SAMDECARB-RXN]]
 
* [[SPERMIDINESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
+
{{#set: common-name=α-glucose 1,6-bisphosphate}}
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
+
{{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}}
{{#set: molecular-weight=356.442}}
+
{{#set: molecular-weight=336.085}}

Revision as of 09:22, 27 August 2019

Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE

  • common-name:
    • α-glucose 1,6-bisphosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
  • inchi-key:
    • rwhozgraxywrnx-vfuothlcsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality