Difference between revisions of "P184-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=ccc...")
(Created page with "Category:pathway == Pathway P184-PWY == * taxonomic-range: ** tax-1224 * common-name: ** protocatechuate degradation i (meta-cleavage pathway) == Reaction(s) found == * ...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] ==
+
== Pathway P184-PWY ==
 +
* taxonomic-range:
 +
** tax-1224
 
* common-name:
 
* common-name:
** (2e,6e)-farnesyl diphosphate
+
** protocatechuate degradation i (meta-cleavage pathway)
* smiles:
+
== Reaction(s) found ==
** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
+
* [[OXALODECARB-RXN]]
* inchi-key:
+
* [[RXN-2464]]
** vwfjdquyciwhtn-yfvjmotdsa-k
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NonePROTOCATECHUATE-45-DIOXYGENASE-RXN PROTOCATECHUATE-45-DIOXYGENASE-RXN]
** 379.306
+
* [None1.2.1.45-RXN 1.2.1.45-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneR107-RXN R107-RXN]
* [[2.5.1.58-RXN]]
+
* [NoneRXN-2463 RXN-2463]
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
* [NoneRXN-9983 RXN-9983]
* [[GGPS]]
+
* [NoneRXN-2462 RXN-2462]
* [[HEMEOSYN-RXN]]
+
{{#set: taxonomic-range=tax-1224}}
* [[RXN-11963]]
+
{{#set: common-name=protocatechuate degradation i (meta-cleavage pathway)}}
* [[RXN-12263]]
+
{{#set: nb reaction found=2}}
* [[RXN-13162]]
+
{{#set: completion rate=0.25}}
* [[RXN-17573]]
+
{{#set: nb total reaction=8}}
* [[RXN-8999]]
 
* [[RXN-9969]]
 
* [[RXN0-5180]]
 
== Reaction(s) known to produce the compound ==
 
* [[2.5.1.58-RXN]]
 
* [[FPPS]]
 
* [[FPPSYN-RXN]]
 
* [[RXN-11963]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
 
{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
 
{{#set: molecular-weight=379.306}}
 

Latest revision as of 10:57, 18 March 2021

Pathway P184-PWY

  • taxonomic-range:
    • tax-1224
  • common-name:
    • protocatechuate degradation i (meta-cleavage pathway)

Reaction(s) found

Reaction(s) not found

  • [NonePROTOCATECHUATE-45-DIOXYGENASE-RXN PROTOCATECHUATE-45-DIOXYGENASE-RXN]
  • [None1.2.1.45-RXN 1.2.1.45-RXN]
  • [NoneR107-RXN R107-RXN]
  • [NoneRXN-2463 RXN-2463]
  • [NoneRXN-9983 RXN-9983]
  • [NoneRXN-2462 RXN-2462]