Difference between revisions of "P185-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * common-name: ** (2s)-pinocembrin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-pinocembrin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** urfcjeuyxnahfi-zdusscgksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.249 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7648]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7647]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-pinocembrin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=urfcjeuyxnahfi-zdusscgksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.249}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-6991
- common-name:
- (2s)-pinocembrin
- smiles:
- c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
- inchi-key:
- urfcjeuyxnahfi-zdusscgksa-m
- molecular-weight:
- 255.249
