Difference between revisions of "P185-PWY"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] ==
+== Pathway LACTOSEUTIL-PWY ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** (2s)-pinocembrin
+** lactose degradation ii
-* smiles:
+== Reaction(s) found ==
-** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
+* [[KETOLACTOSE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** urfcjeuyxnahfi-zdusscgksa-m
+* [NoneLACTOSE-DEHYDRO-RXN LACTOSE-DEHYDRO-RXN]
-* molecular-weight:
+* [NoneKETOGAL-DEHYDROXY-RXN KETOGAL-DEHYDROXY-RXN]
-** 255.249
+{{#set: taxonomic-range=tax-1224}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=lactose degradation ii}}
-* [[RXN-7648]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[RXN-7647]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(2s)-pinocembrin}}
-{{#set: inchi-key=inchikey=urfcjeuyxnahfi-zdusscgksa-m}}
-{{#set: molecular-weight=255.249}}