Difference between revisions of "P23-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAGATOSE-6-PHOSPHATE TAGATOSE-6-PHOSPHATE] ==
+== Pathway PWY-7303 ==
+* taxonomic-range:
+** tax-2062
 * common-name:
-** d-tagatofuranose 6-phosphate
+** 3-dimethylallyl-4-hydroxybenzoate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o
+* [[PREPHENATEDEHYDROG-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** bgwgxpapygqalx-oexcpvawsa-l
+* [NoneRXN-14671 RXN-14671]
-* molecular-weight:
+* [NoneRXN-14631 RXN-14631]
-** 258.121
+* [NoneRXN-14670 RXN-14670]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2062}}
-* [[TAGAKIN-RXN]]
+{{#set: common-name=3-dimethylallyl-4-hydroxybenzoate biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=d-tagatofuranose 6-phosphate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=bgwgxpapygqalx-oexcpvawsa-l}}
-{{#set: molecular-weight=258.121}}