Difference between revisions of "P23-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * common-name: ** o-succinyl-l-homoserine *...")
 
(Created page with "Category:pathway == Pathway P23-PWY == * taxonomic-range: ** tax-3052 ** tax-1224 ** tax-2157 ** tax-68336 ** tax-200783 * common-name: ** reductive tca cycle i == Reactio...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
+
== Pathway P23-PWY ==
 +
* taxonomic-range:
 +
** tax-3052
 +
** tax-1224
 +
** tax-2157
 +
** tax-68336
 +
** tax-200783
 
* common-name:
 
* common-name:
−
** o-succinyl-l-homoserine
+
** reductive tca cycle i
−
* smiles:
+
== Reaction(s) found ==
−
** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
+
* [[ACONITATEDEHYDR-RXN]]
−
* inchi-key:
+
* [[ACONITATEHYDR-RXN]]
−
** gnisqjgxjidkdj-yfkpbyrvsa-m
+
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
−
* molecular-weight:
+
* [[FUMHYDR-RXN]]
−
** 218.186
+
* [[ISOCITDEH-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[MALATE-DEH-RXN]]
−
* [[METBALT-RXN]]
+
* [[PEPCARBOX-RXN]]
−
* [[O-SUCCHOMOSERLYASE-RXN]]
+
* [[PYRUFLAVREDUCT-RXN]]
−
* [[RXN-9384]]
+
* [[SUCCCOASYN-RXN]]
−
* [[SUCHMSSELCYSL]]
+
== Reaction(s) not found ==
−
* [[SUCHMSSELCYSLh]]
+
* [None2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
−
== Reaction(s) known to produce the compound ==
+
* [NoneR601-RXN R601-RXN]
−
* [[HOMSUCTRAN-RXN]]
+
* [NonePEPSYNTH-RXN PEPSYNTH-RXN]
−
* [[O-SUCCHOMOSERLYASE-RXN]]
+
{{#set: taxonomic-range=tax-2157|tax-3052|tax-200783|tax-68336|tax-1224}}
−
* [[RXN-9384]]
+
{{#set: common-name=reductive tca cycle i}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=9}}
−
{{#set: common-name=o-succinyl-l-homoserine}}
+
{{#set: completion rate=0.75}}
−
{{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}}
+
{{#set: nb total reaction=12}}
−
{{#set: molecular-weight=218.186}}
 

Latest revision as of 10:58, 18 March 2021

Pathway P23-PWY

  • taxonomic-range:
    • tax-3052
    • tax-1224
    • tax-2157
    • tax-68336
    • tax-200783
  • common-name:
    • reductive tca cycle i

Reaction(s) found

Reaction(s) not found

  • [None2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
  • [NoneR601-RXN R601-RXN]
  • [NonePEPSYNTH-RXN PEPSYNTH-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=P23-PWY&oldid=130732"