Difference between revisions of "P23-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * common-name: ** o-succinyl-l-homoserine *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monoamines Monoamines] == * common-name: ** a monoamine == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monoamines Monoamines] ==
 
* common-name:
 
* common-name:
** o-succinyl-l-homoserine
+
** a monoamine
* smiles:
 
** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
 
* inchi-key:
 
** gnisqjgxjidkdj-yfkpbyrvsa-m
 
* molecular-weight:
 
** 218.186
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METBALT-RXN]]
+
* [[RXN-9598]]
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-9384]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMSUCTRAN-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-9384]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-succinyl-l-homoserine}}
+
{{#set: common-name=a monoamine}}
{{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}}
 
{{#set: molecular-weight=218.186}}
 

Revision as of 14:18, 26 August 2019

Metabolite Monoamines

  • common-name:
    • a monoamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality