Difference between revisions of "P241-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * common-name: ** cycloartenol * smiles: ** cc(c)=cccc(c)[ch]3(cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
 
* common-name:
 
* common-name:
** 1-deoxy-d-xylulose 5-phosphate
+
** cycloartenol
 
* smiles:
 
* smiles:
** cc(=o)c(o)c(o)cop([o-])(=o)[o-]
+
** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
 
* inchi-key:
 
* inchi-key:
** ajpadpzsrrughi-rfzpgflssa-l
+
** onqrkeuaijmulo-coenlipysa-n
 
* molecular-weight:
 
* molecular-weight:
** 212.096
+
** 426.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DXPREDISOM-RXN]]
+
* [[RXN-4021]]
* [[THIAZOLSYN2-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DXPREDISOM-RXN]]
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
* [[DXS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-deoxy-d-xylulose 5-phosphate}}
+
{{#set: common-name=cycloartenol}}
{{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}}
+
{{#set: inchi-key=inchikey=onqrkeuaijmulo-coenlipysa-n}}
{{#set: molecular-weight=212.096}}
+
{{#set: molecular-weight=426.724}}

Revision as of 14:19, 26 August 2019

Metabolite CYCLOARTENOL

  • common-name:
    • cycloartenol
  • smiles:
    • cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
  • inchi-key:
    • onqrkeuaijmulo-coenlipysa-n
  • molecular-weight:
    • 426.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality