Difference between revisions of "P281-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * common-name: ** trans-2,3-dehydroad...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7830 CPD-7830] == * common-name: ** heptadecanoate * smiles: ** ccccccccccccccccc([o-])=o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7830 CPD-7830] ==
 
* common-name:
 
* common-name:
** trans-2,3-dehydroadipyl-coa
+
** heptadecanoate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccccccccccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
** zfxickrxpztfpb-kcqrsjhasa-i
+
** kemqgtryuadpnz-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 888.606
+
** 269.446
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2425]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2425]]
+
* [[RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-2,3-dehydroadipyl-coa}}
+
{{#set: common-name=heptadecanoate}}
{{#set: inchi-key=inchikey=zfxickrxpztfpb-kcqrsjhasa-i}}
+
{{#set: inchi-key=inchikey=kemqgtryuadpnz-uhfffaoysa-m}}
{{#set: molecular-weight=888.606}}
+
{{#set: molecular-weight=269.446}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-7830

  • common-name:
    • heptadecanoate
  • smiles:
    • ccccccccccccccccc([o-])=o
  • inchi-key:
    • kemqgtryuadpnz-uhfffaoysa-m
  • molecular-weight:
    • 269.446

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality