Difference between revisions of "P3-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] ==
+== Pathway P3-PWY ==
+* taxonomic-range:
+** tax-1239
 * common-name:
-** cis-zeatin-7-n-glucoside
+** gallate degradation iii (anaerobic)
-* smiles:
+== Reaction(s) found ==
-** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
+* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
-* inchi-key:
+* [[PHOSACETYLTRANS-RXN]]
-** htdhrclvwuexis-gihywfgssa-n
+* [[RXN-11667]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 381.388
+* [NoneRXN-16834 RXN-16834]
-== Reaction(s) known to consume the compound ==
+* [NoneR8-RXN R8-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneR6-RXN R6-RXN]
-* [[RXN-4733]]
+* [NoneR5-RXN R5-RXN]
-== Reaction(s) of unknown directionality ==
+* [None1.97.1.2-RXN 1.97.1.2-RXN]
-{{#set: common-name=cis-zeatin-7-n-glucoside}}
+* [NoneGALLATE-DECARBOXYLASE-RXN GALLATE-DECARBOXYLASE-RXN]
-{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}
+* [NoneACETATEKIN-RXN ACETATEKIN-RXN]
-{{#set: molecular-weight=381.388}}
+* [NoneR7-RXN R7-RXN]
+* [NoneR11-RXN R11-RXN]
+{{#set: taxonomic-range=tax-1239}}
+{{#set: common-name=gallate degradation iii (anaerobic)}}
+{{#set: nb reaction found=3}}
+{{#set: completion rate=0.27}}
+{{#set: nb total reaction=11}}