Difference between revisions of "P321-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * smil...")
(Created page with "Category:pathway == Pathway P321-PWY == * taxonomic-range: ** tax-2 * common-name: ** benzoyl-coa degradation iii (anaerobic) == Reaction(s) found == * RXN-8032 == Rea...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] ==
+
== Pathway P321-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** benzoyl-coa degradation iii (anaerobic)
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
+
* [[RXN-8032]]
* inchi-key:
+
== Reaction(s) not found ==
** ycjnyhccoxvyaf-uhfffaoysa-m
+
* [NoneR266-RXN R266-RXN]
* molecular-weight:
+
* [NoneR265-RXN R265-RXN]
** 222.177
+
* [NoneR267-RXN R267-RXN]
== Reaction(s) known to consume the compound ==
+
* [None1.3.99.15-RXN 1.3.99.15-RXN]
* [[RXN-10721]]
+
* [NoneRXN-8031 RXN-8031]
== Reaction(s) known to produce the compound ==
+
* [NoneR268-RXN R268-RXN]
* [[RXN-10721]]
+
* [None1.3.1.62-RXN 1.3.1.62-RXN]
== Reaction(s) of unknown directionality ==
+
* [None1.1.1.259-RXN 1.1.1.259-RXN]
{{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
{{#set: taxonomic-range=tax-2}}
{{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}}
+
{{#set: common-name=benzoyl-coa degradation iii (anaerobic)}}
{{#set: molecular-weight=222.177}}
+
{{#set: nb reaction found=1}}
 +
{{#set: completion rate=0.11}}
 +
{{#set: nb total reaction=9}}

Latest revision as of 10:58, 18 March 2021

Pathway P321-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • benzoyl-coa degradation iii (anaerobic)

Reaction(s) found

Reaction(s) not found

  • [NoneR266-RXN R266-RXN]
  • [NoneR265-RXN R265-RXN]
  • [NoneR267-RXN R267-RXN]
  • [None1.3.99.15-RXN 1.3.99.15-RXN]
  • [NoneRXN-8031 RXN-8031]
  • [NoneR268-RXN R268-RXN]
  • [None1.3.1.62-RXN 1.3.1.62-RXN]
  • [None1.1.1.259-RXN 1.1.1.259-RXN]