Difference between revisions of "P541-PWY"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8083 CPD-8083] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-C-Reduced Cytochromes-C-Reduced] ==
 * common-name:
-** 1-18:2-2-18:3-digalactosyldiacylglycerol
+** a reduced c-type cytochrome
-* smiles:
-** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
-* inchi-key:
-** gkshydzifvnlss-ipdwfasdsa-n
-* molecular-weight:
-** 939.231
 == Reaction(s) known to consume the compound ==
-* [[RXN-8314]]
+* [[1.10.2.2-RXN]]
+* [[CYTOCHROME-C-OXIDASE-RXN]]
+* [[CYTOCHROME-C-PEROXIDASE-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
+* [[RXN-15830]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-8313]]
+* [[1.10.2.2-RXN]]
+* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[RXN-14107]]
+* [[RXN-15816]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol}}
+{{#set: common-name=a reduced c-type cytochrome}}
-{{#set: inchi-key=inchikey=gkshydzifvnlss-ipdwfasdsa-n}}
-{{#set: molecular-weight=939.231}}