Difference between revisions of "P562-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-k...")
(Created page with "Category:pathway == Pathway P562-PWY == * taxonomic-range: ** tax-4751 ** tax-2 * common-name: ** myo-inositol degradation i == Reaction(s) found == * MYO-INOSITOL-2-DEH...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] ==
+
== Pathway P562-PWY ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
−
** l-arginine
+
** myo-inositol degradation i
−
* smiles:
+
== Reaction(s) found ==
−
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
−
* inchi-key:
+
* [[RXN-2902]]
−
** odksfydxxfifqn-bypyzucnsa-o
+
== Reaction(s) not found ==
−
* molecular-weight:
+
* [NoneRXN-14149 RXN-14149]
−
** 175.21
+
* [NoneRXN-14150 RXN-14150]
−
== Reaction(s) known to consume the compound ==
+
* [None4.1.2.29-RXN 4.1.2.29-RXN]
−
* [[1.5.1.11-RXN]]
+
* [NoneMYO-INOSOSE-2-DEHYDRATASE-RXN MYO-INOSOSE-2-DEHYDRATASE-RXN]
−
* [[1.5.1.19-RXN]]
+
* [None5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN 5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN]
−
* [[ARG-OXIDATION-RXN]]
+
{{#set: taxonomic-range=tax-4751|tax-2}}
−
* [[ARGDECARBOX-RXN]]
+
{{#set: common-name=myo-inositol degradation i}}
−
* [[ARGINASE-RXN]]
+
{{#set: nb reaction found=2}}
−
* [[ARGININE--TRNA-LIGASE-RXN]]
+
{{#set: completion rate=0.29}}
−
* [[ARGSUCCINLYA-RXN]]
+
{{#set: nb total reaction=7}}
−
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
−
* [[RXN-13564]]
 
−
* [[biomass_rxn]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[ARGDECARBOX-RXN]]
 
−
* [[ARGINASE-RXN]]
 
−
* [[ARGSUCCINLYA-RXN]]
 
−
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=l-arginine}}
 
−
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
 
−
{{#set: molecular-weight=175.21}}
 

Latest revision as of 10:58, 18 March 2021

Pathway P562-PWY

  • taxonomic-range:
    • tax-4751
    • tax-2
  • common-name:
    • myo-inositol degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14149 RXN-14149]
  • [NoneRXN-14150 RXN-14150]
  • [None4.1.2.29-RXN 4.1.2.29-RXN]
  • [NoneMYO-INOSOSE-2-DEHYDRATASE-RXN MYO-INOSOSE-2-DEHYDRATASE-RXN]
  • [None5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN 5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=P562-PWY&oldid=130909"