Difference between revisions of "P562-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * common-name: ** γ-l-glutamyl 5-phosphate * smiles:...")
 
(Created page with "Category:pathway == Pathway P562-PWY == * taxonomic-range: ** tax-4751 ** tax-2 * common-name: ** myo-inositol degradation i == Reaction(s) found == * MYO-INOSITOL-2-DEH...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] ==
+
== Pathway P562-PWY ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** γ-l-glutamyl 5-phosphate
+
** myo-inositol degradation i
* smiles:
+
== Reaction(s) found ==
** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
* inchi-key:
+
* [[RXN-2902]]
** pjrxvijaernuip-vkhmyheasa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-14149 RXN-14149]
** 225.094
+
* [NoneRXN-14150 RXN-14150]
== Reaction(s) known to consume the compound ==
+
* [None4.1.2.29-RXN 4.1.2.29-RXN]
* [[G5DH]]
+
* [NoneMYO-INOSOSE-2-DEHYDRATASE-RXN MYO-INOSOSE-2-DEHYDRATASE-RXN]
* [[G5DHm]]
+
* [None5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN 5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN]
* [[GLUTSEMIALDEHYDROG-RXN]]
+
{{#set: taxonomic-range=tax-4751|tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=myo-inositol degradation i}}
* [[GLUTKIN-RXN]]
+
{{#set: nb reaction found=2}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.29}}
{{#set: common-name=γ-l-glutamyl 5-phosphate}}
+
{{#set: nb total reaction=7}}
{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
 
{{#set: molecular-weight=225.094}}
 

Latest revision as of 10:58, 18 March 2021

Pathway P562-PWY

  • taxonomic-range:
    • tax-4751
    • tax-2
  • common-name:
    • myo-inositol degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14149 RXN-14149]
  • [NoneRXN-14150 RXN-14150]
  • [None4.1.2.29-RXN 4.1.2.29-RXN]
  • [NoneMYO-INOSOSE-2-DEHYDRATASE-RXN MYO-INOSOSE-2-DEHYDRATASE-RXN]
  • [None5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN 5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN]