Difference between revisions of "PALMITYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...") |
(Created page with "Category:metabolite == Metabolite HCN == * common-name: ** hydrogen cyanide * smiles: ** c#n * inchi-key: ** lelowrisymnnsu-uhfffaoysa-n * molecular-weight: ** 27.026 == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HCN == |
* common-name: | * common-name: | ||
| − | ** | + | ** hydrogen cyanide |
* smiles: | * smiles: | ||
| − | ** | + | ** c#n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lelowrisymnnsu-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 27.026 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RXN0-6359]] |
| + | * [[THIOSULFATE-SULFURTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ETHYL-RXN]] | ||
| + | * [[RXN-13600]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hydrogen cyanide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lelowrisymnnsu-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=27.026}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite HCN
- common-name:
- hydrogen cyanide
- smiles:
- c#n
- inchi-key:
- lelowrisymnnsu-uhfffaoysa-n
- molecular-weight:
- 27.026
