Difference between revisions of "PANTETHEINE-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite dicarboxylate == * common-name: ** a dicarboxylate == Reaction(s) known to consume the compound == * OMEGA-AMIDASE-RXN == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite dicarboxylate == |
* common-name: | * common-name: | ||
− | ** | + | ** a dicarboxylate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[OMEGA-AMIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[OMEGA-AMIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dicarboxylate}} |
− | |||
− |
Revision as of 08:32, 15 March 2021
Contents
Metabolite dicarboxylate
- common-name:
- a dicarboxylate