Difference between revisions of "PANTETHEINE-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.5-RXN 2.1.1.5-RXN] == * direction: ** left-to-right * common-name: ** betaine-homocysteine s-...")
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.5-RXN 2.1.1.5-RXN] ==
+
== Metabolite PANTETHEINE-P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** betaine-homocysteine s-methyltransferase
+
** 4'-phosphopantetheine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.5 ec-2.1.1.5]
+
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[BETAINE]][c] '''+''' 1 [[HOMO-CYS]][c] '''=>''' 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[MET]][c]
+
** jdmuprlruumctl-vifpvbqesa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07112]]
+
** 356.33
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PANTEPADENYLYLTRAN-RXN]]
−
== Pathway(s) ==
+
* [[PANTETHEINE-KINASE-RXN]]
−
* [[ADENOSYLHOMOCYSCAT-PWY]], L-methionine salvage from L-homocysteine: [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSCAT-PWY ADENOSYLHOMOCYSCAT-PWY]
+
== Reaction(s) known to produce the compound ==
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[3.1.4.14-RXN]]
−
* [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661]
+
* [[P-PANTOCYSDECARB-RXN]]
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[PANTETHEINE-KINASE-RXN]]
−
* [[PWY-3661-1]], glycine betaine degradation II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=4'-phosphopantetheine}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=356.33}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22337 22337]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02821 R02821]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=betaine-homocysteine s-methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.5}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite PANTETHEINE-P

  • common-name:
    • 4'-phosphopantetheine
  • smiles:
    • cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
  • inchi-key:
    • jdmuprlruumctl-vifpvbqesa-l
  • molecular-weight:
    • 356.33

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PANTETHEINE-P&oldid=139833"