Difference between revisions of "PANTETHEINE-P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTPOP GTPOP] == * direction: ** left-to-right * common-name: ** gtp:pyruvate 2-o-phosphotransferase...") |
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PANTETHEINE-P == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 4'-phosphopantetheine |
| − | == | + | * smiles: |
| − | + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] | |
| − | == | + | * inchi-key: |
| − | * | + | ** jdmuprlruumctl-vifpvbqesa-l |
| − | * | + | * molecular-weight: |
| − | + | ** 356.33 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[PANTEPADENYLYLTRAN-RXN]] | |
| − | * | + | * [[PANTETHEINE-KINASE-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[3.1.4.14-RXN]] | |
| − | {{#set: common-name= | + | * [[P-PANTOCYSDECARB-RXN]] |
| − | {{#set: | + | * [[PANTETHEINE-KINASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=4'-phosphopantetheine}} |
| − | + | {{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}} | |
| − | + | {{#set: molecular-weight=356.33}} | |
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite PANTETHEINE-P
- common-name:
- 4'-phosphopantetheine
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
- inchi-key:
- jdmuprlruumctl-vifpvbqesa-l
- molecular-weight:
- 356.33
