Difference between revisions of "PANTOTHENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3483 == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** akoaevosdhivfx-uhfffa...") |
(Created page with "Category:metabolite == Metabolite PANTOTHENATE == * common-name: ** (r)-pantothenate * smiles: ** cc(c)(co)c(o)c(=o)nccc(=o)[o-] * inchi-key: ** ghokwgtuzjeaqd-zetcqymhsa-...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PANTOTHENATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-pantothenate |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc(c)(co)c(o)c(=o)nccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ghokwgtuzjeaqd-zetcqymhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 218.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTOTHENATE-KIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-pantothenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghokwgtuzjeaqd-zetcqymhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.229}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PANTOTHENATE
- common-name:
- (r)-pantothenate
- smiles:
- cc(c)(co)c(o)c(=o)nccc(=o)[o-]
- inchi-key:
- ghokwgtuzjeaqd-zetcqymhsa-m
- molecular-weight:
- 218.229
