Difference between revisions of "PAPS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
(Created page with "Category:metabolite == Metabolite CPD0-903 == * common-name: ** n-ethylsuccinimide * smiles: ** ccn1(c(ccc1=o)=o) * inchi-key: ** ghazcvnukkztlg-uhfffaoysa-n * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite CPD0-903 ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** n-ethylsuccinimide
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
+
** ccn1(c(ccc1=o)=o)
 
* inchi-key:
 
* inchi-key:
** buzogvvqwcxxdp-vpeninkcsa-j
+
** ghazcvnukkztlg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 127.143
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11396]]
 
* [[RXN-14205]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14205]]
+
* [[RXN0-5101]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=n-ethylsuccinimide}}
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
+
{{#set: inchi-key=inchikey=ghazcvnukkztlg-uhfffaoysa-n}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=127.143}}

Revision as of 11:19, 15 January 2021

Metabolite CPD0-903

  • common-name:
    • n-ethylsuccinimide
  • smiles:
    • ccn1(c(ccc1=o)=o)
  • inchi-key:
    • ghazcvnukkztlg-uhfffaoysa-n
  • molecular-weight:
    • 127.143

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality