Difference between revisions of "PAPS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARDP ARDP] == * direction: ** left-to-right * common-name: ** adp-ribose diphosphatase == Reaction...")
(Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARDP ARDP] ==
+
== Metabolite PAPS ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** adp-ribose diphosphatase
+
** 3'-phosphoadenylyl-sulfate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[ADENOSINE_DIPHOSPHATE_RIBOSE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[CPD-15318]][c] '''+''' 2.0 [[PROTON]][c]
+
** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ13701]]
+
** gacdqmdrprgctn-kqynxxcusa-j
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 503.23
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[1.8.4.8-RXN]]
−
== External links  ==
+
* [[2.8.2.23-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[2.8.2.29-RXN]]
−
{{#set: common-name=adp-ribose diphosphatase}}
+
* [[2.8.2.30-RXN]]
−
{{#set: nb gene associated=1}}
+
* [[ADENYLYLSULFKIN-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
−
{{#set: reconstruction category=orthology}}
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
−
{{#set: reconstruction tool=pantograph}}
+
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
−
{{#set: reconstruction comment=n.a}}
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 +
* [[PAPSPAPthr]]
 +
* [[R163-RXN]]
 +
* [[RXN-10614]]
 +
* [[RXN-10615]]
 +
* [[RXN-10777]]
 +
* [[RXN-10782]]
 +
* [[RXN-11058]]
 +
* [[RXN-11059]]
 +
* [[RXN-11555]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-17203]]
 +
* [[RXN-18301]]
 +
* [[RXN-18303]]
 +
* [[RXN-701]]
 +
* [[RXN-7953]]
 +
* [[RXN-7954]]
 +
* [[RXN6666-9]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[1.8.4.8-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 +
* [[PAPSPAPthr]]
 +
* [[R163-RXN]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-17203]]
 +
* [[RXN-701]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3'-phosphoadenylyl-sulfate}}
 +
{{#set: inchi-key=inchikey=gacdqmdrprgctn-kqynxxcusa-j}}
 +
{{#set: molecular-weight=503.23}}

Latest revision as of 11:17, 18 March 2021

Metabolite PAPS

  • common-name:
    • 3'-phosphoadenylyl-sulfate
  • smiles:
    • c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • gacdqmdrprgctn-kqynxxcusa-j
  • molecular-weight:
    • 503.23

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PAPS&oldid=139715"