Difference between revisions of "PAPS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] == * direction: ** reversible * common-name:...")
 
(Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] ==
+
== Metabolite PAPS ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** atp phosphoribosyltransferase
+
** 3'-phosphoadenylyl-sulfate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.4.2.17 ec-2.4.2.17]
+
** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
== Reaction formula ==
+
* inchi-key:
* 1 [[PHOSPHORIBOSYL-ATP]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[ATP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PRPP]][c]
+
** gacdqmdrprgctn-kqynxxcusa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ19466]]
+
** 503.23
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
* [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY]
 
** '''10''' reactions found over '''10''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* RHEA:
+
* [[1.8.4.8-RXN]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18476 18476]
+
* [[2.8.2.23-RXN]]
* LIGAND-RXN:
+
* [[2.8.2.29-RXN]]
** [http://www.genome.jp/dbget-bin/www_bget?R01071 R01071]
+
* [[2.8.2.30-RXN]]
* UNIPROT:
+
* [[ADENYLYLSULFKIN-RXN]]
** [http://www.uniprot.org/uniprot/Q9X0D2 Q9X0D2]
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
** [http://www.uniprot.org/uniprot/Q58601 Q58601]
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
** [http://www.uniprot.org/uniprot/O34520 O34520]
+
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
** [http://www.uniprot.org/uniprot/Q9RUE2 Q9RUE2]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
** [http://www.uniprot.org/uniprot/P64347 P64347]
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
** [http://www.uniprot.org/uniprot/Q9PM78 Q9PM78]
+
* [[PAPSPAPthr]]
** [http://www.uniprot.org/uniprot/Q02129 Q02129]
+
* [[R163-RXN]]
** [http://www.uniprot.org/uniprot/P43853 P43853]
+
* [[RXN-10614]]
** [http://www.uniprot.org/uniprot/O67543 O67543]
+
* [[RXN-10615]]
** [http://www.uniprot.org/uniprot/P40373 P40373]
+
* [[RXN-10777]]
** [http://www.uniprot.org/uniprot/P46586 P46586]
+
* [[RXN-10782]]
** [http://www.uniprot.org/uniprot/Q55503 Q55503]
+
* [[RXN-11058]]
** [http://www.uniprot.org/uniprot/Q9S762 Q9S762]
+
* [[RXN-11059]]
** [http://www.uniprot.org/uniprot/P00498 P00498]
+
* [[RXN-11555]]
** [http://www.uniprot.org/uniprot/P00499 P00499]
+
* [[RXN-15587]]
** [http://www.uniprot.org/uniprot/P60757 P60757]
+
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-17203]]
 +
* [[RXN-18301]]
 +
* [[RXN-18303]]
 +
* [[RXN-701]]
 +
* [[RXN-7953]]
 +
* [[RXN-7954]]
 +
* [[RXN6666-9]]
 
</div>
 
</div>
{{#set: direction=reversible}}
+
== Reaction(s) known to produce the compound ==
{{#set: common-name=atp phosphoribosyltransferase}}
+
* [[1.8.4.8-RXN]]
{{#set: ec-number=ec-2.4.2.17}}
+
* [[ADENYLYLSULFKIN-RXN]]
{{#set: nb gene associated=1}}
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
{{#set: nb pathway associated=1}}
+
* [[PAPSPAPthr]]
{{#set: reconstruction category=orthology|annotation}}
+
* [[R163-RXN]]
{{#set: reconstruction tool=pathwaytools|pantograph}}
+
* [[RXN-15587]]
{{#set: reconstruction comment=n.a}}
+
* [[RXN-15588]]
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
+
* [[RXN-15589]]
 +
* [[RXN-17203]]
 +
* [[RXN-701]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3'-phosphoadenylyl-sulfate}}
 +
{{#set: inchi-key=inchikey=gacdqmdrprgctn-kqynxxcusa-j}}
 +
{{#set: molecular-weight=503.23}}

Latest revision as of 11:17, 18 March 2021