Difference between revisions of "PAPS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETHFDEHYDROG-NADP-RXN METHYLENETHFDEHYDROG-NADP-RXN] == * direction: ** reversible * common...")
(Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETHFDEHYDROG-NADP-RXN METHYLENETHFDEHYDROG-NADP-RXN] ==
+
== Metabolite PAPS ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** methylenetetrahydrofolate dehydrogenase (nadp+)
+
** 3'-phosphoadenylyl-sulfate
−
** methylenetetrahydrofolate dehydrogenase
+
* smiles:
−
* ec-number:
+
** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
−
** [http://enzyme.expasy.org/EC/1.5.1.5 ec-1.5.1.5]
+
* inchi-key:
−
== Reaction formula ==
+
** gacdqmdrprgctn-kqynxxcusa-j
−
* 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''+''' 1 [[NADPH]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 503.23
 +
== Reaction(s) known to consume the compound ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* Gene: [[SJ12991]]
+
* [[1.8.4.8-RXN]]
−
** Category: [[annotation]]
+
* [[2.8.2.23-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.8.2.29-RXN]]
−
* Gene: [[SJ02922]]
+
* [[2.8.2.30-RXN]]
−
** Category: [[annotation]]
+
* [[ADENYLYLSULFKIN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
−
** Category: [[orthology]]
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
−
* Gene: [[SJ10799]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PAPSPAPthr]]
−
* Gene: [[SJ17385]]
+
* [[R163-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10614]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-10615]]
−
** Category: [[orthology]]
+
* [[RXN-10777]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-10782]]
−
* Gene: [[SJ11954]]
+
* [[RXN-11058]]
−
** Category: [[annotation]]
+
* [[RXN-11059]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-11555]]
−
** Category: [[orthology]]
+
* [[RXN-15587]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-15588]]
−
* Gene: [[SJ02262]]
+
* [[RXN-15589]]
−
** Category: [[annotation]]
+
* [[RXN-17203]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-18301]]
 +
* [[RXN-18303]]
 +
* [[RXN-701]]
 +
* [[RXN-7953]]
 +
* [[RXN-7954]]
 +
* [[RXN6666-9]]
 
</div>
 
</div>
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
+
* [[1.8.4.8-RXN]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[ADENYLYLSULFKIN-RXN]]
−
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
−
** '''10''' reactions found over '''24''' reactions in the full pathway
+
* [[PAPSPAPthr]]
−
* [[CODH-PWY]], reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY]
+
* [[R163-RXN]]
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-15587]]
−
* [[PWY-7909]], formaldehyde oxidation VII (THF pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7909 PWY-7909]
+
* [[RXN-15588]]
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-15589]]
−
* [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
+
* [[RXN-17203]]
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
* [[RXN-701]]
−
* [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
+
== Reaction(s) of unknown directionality ==
−
** '''9''' reactions found over '''12''' reactions in the full pathway
+
{{#set: common-name=3'-phosphoadenylyl-sulfate}}
−
* [[PWY-1722]], formate assimilation into 5,10-methylenetetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722]
+
{{#set: inchi-key=inchikey=gacdqmdrprgctn-kqynxxcusa-j}}
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=503.23}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22815 22815]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01220 R01220]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P09440 P09440]
 
−
** [http://www.uniprot.org/uniprot/P07245 P07245]
 
−
** [http://www.uniprot.org/uniprot/P11586 P11586]
 
−
** [http://www.uniprot.org/uniprot/P44313 P44313]
 
−
** [http://www.uniprot.org/uniprot/P47259 P47259]
 
−
** [http://www.uniprot.org/uniprot/P54382 P54382]
 
−
** [http://www.uniprot.org/uniprot/O67736 O67736]
 
−
** [http://www.uniprot.org/uniprot/Q9JWI9 Q9JWI9]
 
−
** [http://www.uniprot.org/uniprot/Q9PP68 Q9PP68]
 
−
** [http://www.uniprot.org/uniprot/P24186 P24186]
 
−
** [http://www.uniprot.org/uniprot/Q60006 Q60006]
 
−
** [http://www.uniprot.org/uniprot/Q27772 Q27772]
 
−
** [http://www.uniprot.org/uniprot/P51696 P51696]
 
−
** [http://www.uniprot.org/uniprot/O65269 O65269]
 
−
** [http://www.uniprot.org/uniprot/O65271 O65271]
 
−
** [http://www.uniprot.org/uniprot/O68031 O68031]
 
−
** [http://www.uniprot.org/uniprot/Q9ZTV0 Q9ZTV0]
 
−
** [http://www.uniprot.org/uniprot/Q9X7F6 Q9X7F6]
 
−
</div>
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=methylenetetrahydrofolate dehydrogenase|methylenetetrahydrofolate dehydrogenase (nadp+)}}
 
−
{{#set: ec-number=ec-1.5.1.5}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=7}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PAPS

  • common-name:
    • 3'-phosphoadenylyl-sulfate
  • smiles:
    • c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • gacdqmdrprgctn-kqynxxcusa-j
  • molecular-weight:
    • 503.23

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PAPS&oldid=139715"