Difference between revisions of "PARAOXON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18206 RXN-18206] == * direction: ** reversible == Reaction formula == * 1 CPDQT-37[c] '''+'...")
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18206 RXN-18206] ==
+
== Metabolite PARAOXON ==
* direction:
+
* common-name:
** reversible
+
** paraoxon
== Reaction formula ==
+
* smiles:
* 1 [[CPDQT-37]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-19490]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ21291]]
+
** wymsbxtxohuigt-uhfffaoysa-n
** Category: [[annotation]]
+
* molecular-weight:
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 275.197
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
+
* [[RXN-8746]]
** '''5''' reactions found over '''30''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=paraoxon}}
== External links  ==
+
{{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}}
{{#set: direction=reversible}}
+
{{#set: molecular-weight=275.197}}
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PARAOXON

  • common-name:
    • paraoxon
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
  • inchi-key:
    • wymsbxtxohuigt-uhfffaoysa-n
  • molecular-weight:
    • 275.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality